C13H15ClN2 — CID 157177558
1-(2-chloro-6-methylphenyl)-N-(3,4-dihydro-2H-pyrrol-5-ylmethyl)methanimine (PubChem CID 157177558) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-N-(3,4-dihydro-2H-pyrrol-5-ylmethyl)methanimine.
| Compound Name | 1-(2-chloro-6-methylphenyl)-N-(3,4-dihydro-2H-pyrrol-5-ylmethyl)methanimine |
|---|---|
| PubChem CID | 157177558 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-N-(3,4-dihydro-2H-pyrrol-5-ylmethyl)methanimine |
| SMILES | Cc1cccc(Cl)c1/C=N/CC1=NCCC1 |
| InChI | InChI=1S/C13H15ClN2/c1-10-4-2-6-13(14)12(10)9-15-8-11-5-3-7-16-11/h2,4,6,9H,3,5,7-8H2,1H3/b15-9+ |
| InChIKey | AOEORFFVCDLPJK-OQLLNIDSSA-N |
| XLogP | 3.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|