C13H15Cl3N3- — CID 21179402
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride (PubChem CID 21179402) has the molecular formula C13H15Cl3N3- and a molecular weight of 319.64 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
|---|---|
| PubChem CID | 21179402 |
| Molecular Formula | C13H15Cl3N3- |
| Molecular Weight | 319.64 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
| SMILES | Clc1cccc(Cl)c1/C=N/NC1=NCCCCC1.[Cl-] |
| InChI | InChI=1S/C13H15Cl2N3.ClH/c14-11-5-4-6-12(15)10(11)9-17-18-13-7-2-1-3-8-16-13;/h4-6,9H,1-3,7-8H2,(H,16,18);1H/p-1/b17-9+; |
| InChIKey | HEMVNXRWAJZVKJ-WWIHJBQESA-M |
| XLogP | 0.89 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.64 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|