C13H16BrClN3- — CID 21236185
N-[(E)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride (PubChem CID 21236185) has the molecular formula C13H16BrClN3- and a molecular weight of 329.65 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
|---|---|
| PubChem CID | 21236185 |
| Molecular Formula | C13H16BrClN3- |
| Molecular Weight | 329.65 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
| SMILES | Brc1ccc(/C=N/NC2=NCCCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C13H16BrN3.ClH/c14-12-7-5-11(6-8-12)10-16-17-13-4-2-1-3-9-15-13;/h5-8,10H,1-4,9H2,(H,15,17);1H/p-1/b16-10+; |
| InChIKey | JHRWORGBRDVICF-QFHYWFJHSA-M |
| XLogP | 0.35 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.65 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|