C14H19N3O2 — CID 677794
[4-[(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenoxy]methanol (PubChem CID 677794) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is [4-[(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenoxy]methanol.
| Compound Name | [4-[(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenoxy]methanol |
|---|---|
| PubChem CID | 677794 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [4-[(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenoxy]methanol |
| SMILES | OCOc1ccc(C=NNC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C14H19N3O2/c18-11-19-13-7-5-12(6-8-13)10-16-17-14-4-2-1-3-9-15-14/h5-8,10,18H,1-4,9,11H2,(H,15,17) |
| InChIKey | XWPYBPBUYDAAKU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|