C13H17BrClN3O — CID 135576936
4-bromo-2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride (PubChem CID 135576936) has the molecular formula C13H17BrClN3O and a molecular weight of 346.66 g/mol. Its IUPAC name is 4-bromo-2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride.
| Compound Name | 4-bromo-2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 135576936 |
| Molecular Formula | C13H17BrClN3O |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-bromo-2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Br)cc1/C=N/NC1=NCCCCC1 |
| InChI | InChI=1S/C13H16BrN3O.ClH/c14-11-5-6-12(18)10(8-11)9-16-17-13-4-2-1-3-7-15-13;/h5-6,8-9,18H,1-4,7H2,(H,15,17);1H/b16-9+; |
| InChIKey | IXSUDOUINAAQON-QOVZSLTQSA-N |
| XLogP | 3.47 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|