C15H20ClN3O2 — CID 73242471
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride (PubChem CID 73242471) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 73242471 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
| SMILES | C(=NNC1=NCCCCC1)c1ccc2c(c1)OCCO2.Cl |
| InChI | InChI=1S/C15H19N3O2.ClH/c1-2-4-15(16-7-3-1)18-17-11-12-5-6-13-14(10-12)20-9-8-19-13;/h5-6,10-11H,1-4,7-9H2,(H,16,18);1H |
| InChIKey | BUIVSFUMLLOVHB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|