C15H12ClF2N — CID 102159889
N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methylphenyl)methanimine (PubChem CID 102159889) has the molecular formula C15H12ClF2N and a molecular weight of 279.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methylphenyl)methanimine.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methylphenyl)methanimine |
|---|---|
| PubChem CID | 102159889 |
| Molecular Formula | C15H12ClF2N |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methylphenyl)methanimine |
| SMILES | Cc1cc(F)cc(F)c1/C=N/Cc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClF2N/c1-10-6-12(17)7-15(18)13(10)9-19-8-11-4-2-3-5-14(11)16/h2-7,9H,8H2,1H3/b19-9+ |
| InChIKey | ZVVGSPZTXDARRS-DJKKODMXSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|