C15H12ClF2NO — CID 101462836
N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methoxyphenyl)methanimine (PubChem CID 101462836) has the molecular formula C15H12ClF2NO and a molecular weight of 295.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methoxyphenyl)methanimine.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 101462836 |
| Molecular Formula | C15H12ClF2NO |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-(2,4-difluoro-6-methoxyphenyl)methanimine |
| SMILES | COc1cc(F)cc(F)c1/C=N/Cc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClF2NO/c1-20-15-7-11(17)6-14(18)12(15)9-19-8-10-4-2-3-5-13(10)16/h2-7,9H,8H2,1H3/b19-9+ |
| InChIKey | LRDZKJPGONSXLZ-DJKKODMXSA-N |
| XLogP | 4.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|