C9H9ClF3N3 — CID 62379408
1-[2-chloro-6-(trifluoromethyl)phenyl]-2-methylguanidine (PubChem CID 62379408) has the molecular formula C9H9ClF3N3 and a molecular weight of 251.64 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)phenyl]-2-methylguanidine.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 62379408 |
| Molecular Formula | C9H9ClF3N3 |
| Molecular Weight | 251.64 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)phenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N3/c1-15-8(14)16-7-5(9(11,12)13)3-2-4-6(7)10/h2-4H,1H3,(H3,14,15,16) |
| InChIKey | JJSCTPQUDQCPAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|