About 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate
2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate (PubChem CID 144572449) has the molecular formula C21H24ClF3N2O3
and a molecular weight of 444.88 g/mol. Its IUPAC name is 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate.
Molecular Properties
| Compound Name | 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate |
| PubChem CID | 144572449 |
| Molecular Formula | C21H24ClF3N2O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate |
| SMILES | CC.O=Cc1c(Cl)cccc1C(F)(F)F.[H]/N=C(\C)c1ccc(C(=O)OC)cc1NC |
| InChI | InChI=1S/C11H14N2O2.C8H4ClF3O.C2H6/c1-7(12)9-5-4-8(11(14)15-3)6-10(9)13-2;9-7-3-1-2-6(5(7)4-13)8(10,11)12;1-2/h4-6,12-13H,1-3H3;1-4H;1-2H3/b12-7+;; |
| InChIKey | TZPVOYFTHCVQES-CURPJKDSSA-N |
| XLogP | 6.10 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate?
The IUPAC name of 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate (CID 144572449) is 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate.
What is the SMILES notation for 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate?
The canonical SMILES for 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate is CC.O=Cc1c(Cl)cccc1C(F)(F)F.[H]/N=C(\C)c1ccc(C(=O)OC)cc1NC.
What is the InChIKey of 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate?
The InChIKey is TZPVOYFTHCVQES-CURPJKDSSA-N. The full InChI is InChI=1S/C11H14N2O2.C8H4ClF3O.C2H6/c1-7(12)9-5-4-8(11(14)15-3)6-10(9)13-2;9-7-3-1-2-6(5(7)4-13)8(10,11)12;1-2/h4-6,12-13H,1-3H3;1-4H;1-2H3/b12-7+;;.
What are the key properties of 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate?
2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate has a molecular weight of 444.88 g/mol, XLogP of 6.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(trifluoromethyl)benzaldehyde;ethane;methyl 4-ethanimidoyl-3-(methylamino)benzoate is sourced from PubChem (CID 144572449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).