C11H16Cl2N2 — CID 144540373
4,5-dichloro-2-ethanimidoyl-N-methylaniline;ethane (PubChem CID 144540373) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 4,5-dichloro-2-ethanimidoyl-N-methylaniline;ethane.
| Compound Name | 4,5-dichloro-2-ethanimidoyl-N-methylaniline;ethane |
|---|---|
| PubChem CID | 144540373 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4,5-dichloro-2-ethanimidoyl-N-methylaniline;ethane |
| SMILES | CC.[H]/N=C(\C)c1cc(Cl)c(Cl)cc1NC |
| InChI | InChI=1S/C9H10Cl2N2.C2H6/c1-5(12)6-3-7(10)8(11)4-9(6)13-2;1-2/h3-4,12-13H,1-2H3;1-2H3/b12-5+; |
| InChIKey | YSKATFVRXLMGKT-NKPNRJPBSA-N |
| XLogP | 4.45 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|