C12H12Cl2N2O3S — CID 173394583
2-[[(2,6-dichlorophenyl)methylideneamino]-(3-sulfanylpropanoyl)amino]acetic acid (PubChem CID 173394583) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is 2-[[(2,6-dichlorophenyl)methylideneamino]-(3-sulfanylpropanoyl)amino]acetic acid.
| Compound Name | 2-[[(2,6-dichlorophenyl)methylideneamino]-(3-sulfanylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 173394583 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-[[(2,6-dichlorophenyl)methylideneamino]-(3-sulfanylpropanoyl)amino]acetic acid |
| SMILES | O=C(O)CN(N=Cc1c(Cl)cccc1Cl)C(=O)CCS |
| InChI | InChI=1S/C12H12Cl2N2O3S/c13-9-2-1-3-10(14)8(9)6-15-16(7-12(18)19)11(17)4-5-20/h1-3,6,20H,4-5,7H2,(H,18,19) |
| InChIKey | KNDDFSZNNVHAAF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|