C17H12ClNO3S — CID 134052740
(4-methoxyphenyl) 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 134052740) has the molecular formula C17H12ClNO3S and a molecular weight of 345.81 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-methoxyphenyl) 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 134052740 |
| Molecular Formula | C17H12ClNO3S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (4-methoxyphenyl) 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(OC(=O)c2csc(-c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C17H12ClNO3S/c1-21-13-5-7-14(8-6-13)22-17(20)15-10-23-16(19-15)11-3-2-4-12(18)9-11/h2-10H,1H3 |
| InChIKey | ZKIHKMDQSDKEBK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|