C24H18N2O4S — CID 26663350
(4-benzamidophenyl) 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 26663350) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is (4-benzamidophenyl) 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-benzamidophenyl) 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 26663350 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (4-benzamidophenyl) 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(-c2nc(C(=O)Oc3ccc(NC(=O)c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H18N2O4S/c1-29-19-11-7-17(8-12-19)23-26-21(15-31-23)24(28)30-20-13-9-18(10-14-20)25-22(27)16-5-3-2-4-6-16/h2-15H,1H3,(H,25,27) |
| InChIKey | DOIFPHLKJINIPH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|