C17H12ClN3O4S — CID 112773660
2-(3-chlorophenyl)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 112773660) has the molecular formula C17H12ClN3O4S and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 112773660 |
| Molecular Formula | C17H12ClN3O4S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1csc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H12ClN3O4S/c1-25-15-6-5-12(21(23)24)8-13(15)19-16(22)14-9-26-17(20-14)10-3-2-4-11(18)7-10/h2-9H,1H3,(H,19,22) |
| InChIKey | ZBHOEPPGYMUYAQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|