C19H11ClF3N3O5S — CID 27789186
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 27789186) has the molecular formula C19H11ClF3N3O5S and a molecular weight of 485.83 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 27789186 |
| Molecular Formula | C19H11ClF3N3O5S |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1csc(-c2cccc(Cl)c2)n1)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C19H11ClF3N3O5S/c20-11-3-1-2-10(6-11)17-25-15(9-32-17)18(28)31-8-16(27)24-14-5-4-12(26(29)30)7-13(14)19(21,22)23/h1-7,9H,8H2,(H,24,27) |
| InChIKey | KXPHKMHVEKCCAF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|