C18H14N4O6S — CID 84554999
2-(1,3-benzodioxol-5-ylamino)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 84554999) has the molecular formula C18H14N4O6S and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84554999 |
| Molecular Formula | C18H14N4O6S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(2-methoxy-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1csc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H14N4O6S/c1-26-14-5-3-11(22(24)25)7-12(14)20-17(23)13-8-29-18(21-13)19-10-2-4-15-16(6-10)28-9-27-15/h2-8H,9H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | GDQWCEMIBSGRHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|