C17H14N4O5S2 — CID 84555005
2-(1,3-benzodioxol-5-ylamino)-N-(4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 84555005) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84555005 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(4-sulfamoylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2csc(Nc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C17H14N4O5S2/c18-28(23,24)12-4-1-10(2-5-12)19-16(22)13-8-27-17(21-13)20-11-3-6-14-15(7-11)26-9-25-14/h1-8H,9H2,(H,19,22)(H,20,21)(H2,18,23,24) |
| InChIKey | ZUNOUEXXPDOBDQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |