C21H27NO7 — CID 143947780
[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-propylhexanoate (PubChem CID 143947780) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-propylhexanoate.
| Compound Name | [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-propylhexanoate |
|---|---|
| PubChem CID | 143947780 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-propylhexanoate |
| SMILES | CCCCC(CCC)C(=O)Oc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C21H27NO7/c1-3-5-7-16(6-4-2)20(25)28-17-10-8-15(9-11-17)14-27-21(26)29-22-18(23)12-13-19(22)24/h8-11,16H,3-7,12-14H2,1-2H3 |
| InChIKey | VZAKEHBFCHKRQO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|