C20H23NO4 — CID 138751842
(2,5-dioxopyrrolidin-1-yl) 4-[[(2Z)-cyclooct-2-en-1-yl]methyl]benzoate (PubChem CID 138751842) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[(2Z)-cyclooct-2-en-1-yl]methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(2Z)-cyclooct-2-en-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 138751842 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(2Z)-cyclooct-2-en-1-yl]methyl]benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(CC2/C=C\CCCCC2)cc1 |
| InChI | InChI=1S/C20H23NO4/c22-18-12-13-19(23)21(18)25-20(24)17-10-8-16(9-11-17)14-15-6-4-2-1-3-5-7-15/h4,6,8-11,15H,1-3,5,7,12-14H2/b6-4- |
| InChIKey | NKXKGOWQEGNIEY-XQRVVYSFSA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|