C20H19NO4 — CID 138460094
(2,5-dioxopyrrolidin-1-yl) 4-[(3-ethylphenyl)methyl]benzoate (PubChem CID 138460094) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(3-ethylphenyl)methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(3-ethylphenyl)methyl]benzoate |
|---|---|
| PubChem CID | 138460094 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(3-ethylphenyl)methyl]benzoate |
| SMILES | CCc1cccc(Cc2ccc(C(=O)ON3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C20H19NO4/c1-2-14-4-3-5-16(12-14)13-15-6-8-17(9-7-15)20(24)25-21-18(22)10-11-19(21)23/h3-9,12H,2,10-11,13H2,1H3 |
| InChIKey | CXSDHKKADHPXKM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|