C12H18O5 — CID 174263280
methyl (1R,4E,6S)-6-acetyloxy-1-hydroxycyclooct-4-ene-1-carboxylate (PubChem CID 174263280) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl (1R,4E,6S)-6-acetyloxy-1-hydroxycyclooct-4-ene-1-carboxylate.
| Compound Name | methyl (1R,4E,6S)-6-acetyloxy-1-hydroxycyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 174263280 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl (1R,4E,6S)-6-acetyloxy-1-hydroxycyclooct-4-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC/C=C\[C@@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C12H18O5/c1-9(13)17-10-5-3-4-7-12(15,8-6-10)11(14)16-2/h3,5,10,15H,4,6-8H2,1-2H3/b5-3-/t10-,12-/m1/s1 |
| InChIKey | AJWVFHYTOPLLHM-SIIXBRRKSA-N |
| XLogP | 0.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|