C25H22F5NO6 — CID 169150473
[(1R,2E,6S)-6-[(4-acetylphenyl)methylcarbamoyl]-6-hydroxycyclooct-2-en-1-yl] (2,3,4,5,6-pentafluorophenyl) carbonate (PubChem CID 169150473) has the molecular formula C25H22F5NO6 and a molecular weight of 527.44 g/mol. Its IUPAC name is [(1R,2E,6S)-6-[(4-acetylphenyl)methylcarbamoyl]-6-hydroxycyclooct-2-en-1-yl] (2,3,4,5,6-pentafluorophenyl) carbonate.
| Compound Name | [(1R,2E,6S)-6-[(4-acetylphenyl)methylcarbamoyl]-6-hydroxycyclooct-2-en-1-yl] (2,3,4,5,6-pentafluorophenyl) carbonate |
|---|---|
| PubChem CID | 169150473 |
| Molecular Formula | C25H22F5NO6 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [(1R,2E,6S)-6-[(4-acetylphenyl)methylcarbamoyl]-6-hydroxycyclooct-2-en-1-yl] (2,3,4,5,6-pentafluorophenyl) carbonate |
| SMILES | CC(=O)c1ccc(CNC(=O)[C@]2(O)CC/C=C\[C@H](OC(=O)Oc3c(F)c(F)c(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C25H22F5NO6/c1-13(32)15-7-5-14(6-8-15)12-31-23(33)25(35)10-3-2-4-16(9-11-25)36-24(34)37-22-20(29)18(27)17(26)19(28)21(22)30/h2,4-8,16,35H,3,9-12H2,1H3,(H,31,33)/b4-2-/t16-,25-/m0/s1 |
| InChIKey | PZUDVVVIBBJTLU-ASMKKBGMSA-N |
| XLogP | 4.65 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|