C25H32FN3O2 — CID 156824726
ethane;(1R)-N-[[4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]phenyl]methyl]cyclohex-2-ene-1-carboxamide (PubChem CID 156824726) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is ethane;(1R)-N-[[4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]phenyl]methyl]cyclohex-2-ene-1-carboxamide.
| Compound Name | ethane;(1R)-N-[[4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]phenyl]methyl]cyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 156824726 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | ethane;(1R)-N-[[4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]phenyl]methyl]cyclohex-2-ene-1-carboxamide |
| SMILES | CC.O=C(NCc1ccc(F)cc1)NCc1ccc(CNC(=O)[C@H]2C=CCCC2)cc1 |
| InChI | InChI=1S/C23H26FN3O2.C2H6/c24-21-12-10-19(11-13-21)16-27-23(29)26-15-18-8-6-17(7-9-18)14-25-22(28)20-4-2-1-3-5-20;1-2/h2,4,6-13,20H,1,3,5,14-16H2,(H,25,28)(H2,26,27,29);1-2H3/t20-;/m0./s1 |
| InChIKey | YOBHAGAARXVTHA-BDQAORGHSA-N |
| XLogP | 4.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|