C39H53F5N2O7 — CID 169150453
(4E)-N-[3-[4-[(4-acetylphenyl)methylamino]-2,2-dimethyl-4-oxobutoxy]-2,2-dimethylpropyl]-6-methoxycyclooct-4-ene-1-carboxamide;ethane;(2,3,4,5,6-pentafluorophenyl) formate (PubChem CID 169150453) has the molecular formula C39H53F5N2O7 and a molecular weight of 756.85 g/mol. Its IUPAC name is (4E)-N-[3-[4-[(4-acetylphenyl)methylamino]-2,2-dimethyl-4-oxobutoxy]-2,2-dimethylpropyl]-6-methoxycyclooct-4-ene-1-carboxamide;ethane;(2,3,4,5,6-pentafluorophenyl) formate.
| Compound Name | (4E)-N-[3-[4-[(4-acetylphenyl)methylamino]-2,2-dimethyl-4-oxobutoxy]-2,2-dimethylpropyl]-6-methoxycyclooct-4-ene-1-carboxamide;ethane;(2,3,4,5,6-pentafluorophenyl) formate |
|---|---|
| PubChem CID | 169150453 |
| Molecular Formula | C39H53F5N2O7 |
| Molecular Weight | 756.85 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | (4E)-N-[3-[4-[(4-acetylphenyl)methylamino]-2,2-dimethyl-4-oxobutoxy]-2,2-dimethylpropyl]-6-methoxycyclooct-4-ene-1-carboxamide;ethane;(2,3,4,5,6-pentafluorophenyl) formate |
| SMILES | CC.COC1/C=C\CCC(C(=O)NCC(C)(C)COCC(C)(C)CC(=O)NCc2ccc(C(C)=O)cc2)CC1.O=COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H46N2O5.C7HF5O2.C2H6/c1-22(33)24-13-11-23(12-14-24)18-31-27(34)17-29(2,3)20-37-21-30(4,5)19-32-28(35)25-9-7-8-10-26(36-6)16-15-25;8-2-3(9)5(11)7(14-1-13)6(12)4(2)10;1-2/h8,10-14,25-26H,7,9,15-21H2,1-6H3,(H,31,34)(H,32,35);1H;1-2H3/b10-8-;; |
| InChIKey | MZNVJALWSBFQTR-GPWRMYTLSA-N |
| XLogP | 7.79 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.85 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|