C20H23N3O9 — CID 155421512
(2,5-dioxopyrrolidin-1-yl) (1S,4E,6R)-6-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoyloxy]-1-hydroxycyclooct-4-ene-1-carboxylate (PubChem CID 155421512) has the molecular formula C20H23N3O9 and a molecular weight of 449.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (1S,4E,6R)-6-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoyloxy]-1-hydroxycyclooct-4-ene-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (1S,4E,6R)-6-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoyloxy]-1-hydroxycyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 155421512 |
| Molecular Formula | C20H23N3O9 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (1S,4E,6R)-6-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoyloxy]-1-hydroxycyclooct-4-ene-1-carboxylate |
| SMILES | O=C(NCCN1C(=O)C=CC1=O)O[C@H]1/C=C\CC[C@@](O)(C(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C20H23N3O9/c24-14-4-5-15(25)22(14)12-11-21-19(29)31-13-3-1-2-9-20(30,10-8-13)18(28)32-23-16(26)6-7-17(23)27/h1,3-5,13,30H,2,6-12H2,(H,21,29)/b3-1-/t13-,20-/m0/s1 |
| InChIKey | ZNYWWHVJFZUEHR-KMOIONAUSA-N |
| XLogP | -0.53 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|