C22H35N3O7 — CID 166005351
[(1S,2E,6S)-6-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-methylcyclooct-2-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate (PubChem CID 166005351) has the molecular formula C22H35N3O7 and a molecular weight of 453.54 g/mol. Its IUPAC name is [(1S,2E,6S)-6-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-methylcyclooct-2-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate.
| Compound Name | [(1S,2E,6S)-6-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-methylcyclooct-2-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166005351 |
| Molecular Formula | C22H35N3O7 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [(1S,2E,6S)-6-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-methylcyclooct-2-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
| SMILES | C[C@]1(C(=O)CN2C(=O)CCC2=O)CC/C=C\[C@@H](OC(=O)NCCOCCOCCN)CC1 |
| InChI | InChI=1S/C22H35N3O7/c1-22(18(26)16-25-19(27)5-6-20(25)28)8-3-2-4-17(7-9-22)32-21(29)24-11-13-31-15-14-30-12-10-23/h2,4,17H,3,5-16,23H2,1H3,(H,24,29)/b4-2-/t17-,22+/m1/s1 |
| InChIKey | VZSCGXMGVGHJOZ-UBHNPTONSA-N |
| XLogP | 0.93 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|