C28H39N3O9S — CID 162405437
3-amino-6-[2-[2-[2-[2-[[(1S,2E)-cyclooct-2-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-5-methyl-7-oxo-8H-naphthalene-2-sulfonic acid (PubChem CID 162405437) has the molecular formula C28H39N3O9S and a molecular weight of 593.70 g/mol. Its IUPAC name is 3-amino-6-[2-[2-[2-[2-[[(1S,2E)-cyclooct-2-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-5-methyl-7-oxo-8H-naphthalene-2-sulfonic acid.
| Compound Name | 3-amino-6-[2-[2-[2-[2-[[(1S,2E)-cyclooct-2-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-5-methyl-7-oxo-8H-naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 162405437 |
| Molecular Formula | C28H39N3O9S |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 3-amino-6-[2-[2-[2-[2-[[(1S,2E)-cyclooct-2-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-5-methyl-7-oxo-8H-naphthalene-2-sulfonic acid |
| SMILES | CC1=C(CC(=O)NCCOCCOCCNC(=O)O[C@@H]2/C=C\CCCCC2)C(=O)Cc2cc(S(=O)(=O)O)c(N)cc21 |
| InChI | InChI=1S/C28H39N3O9S/c1-19-22-17-24(29)26(41(35,36)37)16-20(22)15-25(32)23(19)18-27(33)30-9-11-38-13-14-39-12-10-31-28(34)40-21-7-5-3-2-4-6-8-21/h5,7,16-17,21H,2-4,6,8-15,18,29H2,1H3,(H,30,33)(H,31,34)(H,35,36,37)/b7-5-/t21-/m1/s1 |
| InChIKey | LETUXQGDJGOXTL-JEUZPXFCSA-N |
| XLogP | 2.57 |
| TPSA | 183.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|