About methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate
methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate (PubChem CID 64744701) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate.
Analyze methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate (CID 64744701) is methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate is COC(=O)C1(O)CCC(C)C(C)C1.
What is the InChIKey of methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate?
The InChIKey is OYYMMRJPWIRFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7-4-5-10(12,6-8(7)2)9(11)13-3/h7-8,12H,4-6H2,1-3H3.
What are the key properties of methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate?
methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-hydroxy-3,4-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 64744701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).