methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate

C10H18O3 — CID 64756046

IUPACmethyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate
SMILESCOC(=O)C1(O)CCC(C)CC1C
InChIInChI=1S/C10H18O3/c1-7-4-5-10(12,8(2)6-7)9(11)13-3/h7-8,12H,4-6H2,1-3H3
InChIKeyZUMJCEYPPOIJAV-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.35
Rot. Bonds1

About methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate

methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate (PubChem CID 64756046) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate
PubChem CID64756046
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Namemethyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate
SMILESCOC(=O)C1(O)CCC(C)CC1C
InChIInChI=1S/C10H18O3/c1-7-4-5-10(12,8(2)6-7)9(11)13-3/h7-8,12H,4-6H2,1-3H3
InChIKeyZUMJCEYPPOIJAV-UHFFFAOYSA-N
XLogP1.35
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate (CID 64756046) is methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate is COC(=O)C1(O)CCC(C)CC1C.
What is the InChIKey of methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate?
The InChIKey is ZUMJCEYPPOIJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7-4-5-10(12,8(2)6-7)9(11)13-3/h7-8,12H,4-6H2,1-3H3.
What are the key properties of methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate?
methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-hydroxy-2,4-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 64756046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).