About methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate
methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate (PubChem CID 82856905) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate.
Analyze methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate?
The IUPAC name of methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate (CID 82856905) is methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate.
What is the SMILES notation for methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate?
The canonical SMILES for methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate is COC(=O)C1(O)CCN2CCCC21.
What is the InChIKey of methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate?
The InChIKey is RZKZWHIVVXCARI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-13-8(11)9(12)4-6-10-5-2-3-7(9)10/h7,12H,2-6H2,1H3.
What are the key properties of methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate?
methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate has a molecular weight of 185.22 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizine-1-carboxylate is sourced from PubChem (CID 82856905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).