C12H19NO4 — CID 102082195
dimethyl 3,5,6,7,8,8a-hexahydro-2H-indolizine-1,1-dicarboxylate (PubChem CID 102082195) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is dimethyl 3,5,6,7,8,8a-hexahydro-2H-indolizine-1,1-dicarboxylate.
| Compound Name | dimethyl 3,5,6,7,8,8a-hexahydro-2H-indolizine-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102082195 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | dimethyl 3,5,6,7,8,8a-hexahydro-2H-indolizine-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCN2CCCCC21 |
| InChI | InChI=1S/C12H19NO4/c1-16-10(14)12(11(15)17-2)6-8-13-7-4-3-5-9(12)13/h9H,3-8H2,1-2H3 |
| InChIKey | GQXFRPNHNLHNLS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|