C10H15NO5 — CID 14119759
dimethyl 3a,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3-dicarboxylate (PubChem CID 14119759) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is dimethyl 3a,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3-dicarboxylate.
| Compound Name | dimethyl 3a,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 14119759 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | dimethyl 3a,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CON2CCCC21 |
| InChI | InChI=1S/C10H15NO5/c1-14-8(12)10(9(13)15-2)6-16-11-5-3-4-7(10)11/h7H,3-6H2,1-2H3 |
| InChIKey | VSEHAQSYANAOFB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|