C10H17NO2 — CID 50941594
methyl (3aS,6aS)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate (PubChem CID 50941594) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl (3aS,6aS)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | methyl (3aS,6aS)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 50941594 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | methyl (3aS,6aS)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
| SMILES | COC(=O)N1CC[C@]2(C)CCC[C@H]12 |
| InChI | InChI=1S/C10H17NO2/c1-10-5-3-4-8(10)11(7-6-10)9(12)13-2/h8H,3-7H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | WDFQXVLUZBJZSL-WPRPVWTQSA-N |
| XLogP | 2.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |