C20H27N3O5 — CID 138048893
N-(cyclopropylmethyl)-N'-[1-[5-(methoxymethyl)furan-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]oxamide (PubChem CID 138048893) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-[1-[5-(methoxymethyl)furan-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]oxamide.
| Compound Name | N-(cyclopropylmethyl)-N'-[1-[5-(methoxymethyl)furan-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]oxamide |
|---|---|
| PubChem CID | 138048893 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-[1-[5-(methoxymethyl)furan-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]oxamide |
| SMILES | COCc1ccc(C(=O)N2CCC3(NC(=O)C(=O)NCC4CC4)CCCC23)o1 |
| InChI | InChI=1S/C20H27N3O5/c1-27-12-14-6-7-15(28-14)19(26)23-10-9-20(8-2-3-16(20)23)22-18(25)17(24)21-11-13-4-5-13/h6-7,13,16H,2-5,8-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | HMCFRQGOVGEEGC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|