ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate

C14H27NO2 — CID 64754128

IUPACethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate
SMILESCCCNC1(C(=O)OCC)CCC(C)CC1C
InChIInChI=1S/C14H27NO2/c1-5-9-15-14(13(16)17-6-2)8-7-11(3)10-12(14)4/h11-12,15H,5-10H2,1-4H3
InChIKeyAZHQICMSAMUDHH-UHFFFAOYSA-N
MW241.37 g/mol
LogP2.74
Rot. Bonds5

About ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate

ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate (PubChem CID 64754128) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate.

Molecular Properties

Compound Nameethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate
PubChem CID64754128
Molecular FormulaC14H27NO2
Molecular Weight241.37 g/mol
Exact Mass241.20
IUPAC Nameethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate
SMILESCCCNC1(C(=O)OCC)CCC(C)CC1C
InChIInChI=1S/C14H27NO2/c1-5-9-15-14(13(16)17-6-2)8-7-11(3)10-12(14)4/h11-12,15H,5-10H2,1-4H3
InChIKeyAZHQICMSAMUDHH-UHFFFAOYSA-N
XLogP2.74
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.37
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate (CID 64754128) is ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate is CCCNC1(C(=O)OCC)CCC(C)CC1C.
What is the InChIKey of ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate?
The InChIKey is AZHQICMSAMUDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-5-9-15-14(13(16)17-6-2)8-7-11(3)10-12(14)4/h11-12,15H,5-10H2,1-4H3.
What are the key properties of ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate?
ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate has a molecular weight of 241.37 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dimethyl-1-(propylamino)cyclohexane-1-carboxylate is sourced from PubChem (CID 64754128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).