C9H13NO3 — CID 130942720
methyl (1S)-1-carbamoyl-2-methylidenecyclopentane-1-carboxylate (PubChem CID 130942720) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl (1S)-1-carbamoyl-2-methylidenecyclopentane-1-carboxylate.
| Compound Name | methyl (1S)-1-carbamoyl-2-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 130942720 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | methyl (1S)-1-carbamoyl-2-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CCC[C@]1(C(N)=O)C(=O)OC |
| InChI | InChI=1S/C9H13NO3/c1-6-4-3-5-9(6,7(10)11)8(12)13-2/h1,3-5H2,2H3,(H2,10,11)/t9-/m0/s1 |
| InChIKey | XIDZOSHRHBFUBE-VIFPVBQESA-N |
| XLogP | 0.37 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|