C21H26O7 — CID 11176775
dimethyl (2E)-3-methylidene-2-[(3,4,5-trimethoxyphenyl)methylidene]cyclohexane-1,1-dicarboxylate (PubChem CID 11176775) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is dimethyl (2E)-3-methylidene-2-[(3,4,5-trimethoxyphenyl)methylidene]cyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (2E)-3-methylidene-2-[(3,4,5-trimethoxyphenyl)methylidene]cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11176775 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | dimethyl (2E)-3-methylidene-2-[(3,4,5-trimethoxyphenyl)methylidene]cyclohexane-1,1-dicarboxylate |
| SMILES | C=C1CCCC(C(=O)OC)(C(=O)OC)/C1=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26O7/c1-13-8-7-9-21(19(22)27-5,20(23)28-6)15(13)10-14-11-16(24-2)18(26-4)17(12-14)25-3/h10-12H,1,7-9H2,2-6H3/b15-10+ |
| InChIKey | UGLUVZIXNOGVMO-XNTDXEJSSA-N |
| XLogP | 3.17 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|