C16H28OSi — CID 11140009
(3Z,3aR,7R,7aS)-3a,7,7a-trimethyl-3-(trimethylsilylmethylidene)-2,5,6,7-tetrahydro-1H-inden-4-one (PubChem CID 11140009) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is (3Z,3aR,7R,7aS)-3a,7,7a-trimethyl-3-(trimethylsilylmethylidene)-2,5,6,7-tetrahydro-1H-inden-4-one.
| Compound Name | (3Z,3aR,7R,7aS)-3a,7,7a-trimethyl-3-(trimethylsilylmethylidene)-2,5,6,7-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 11140009 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (3Z,3aR,7R,7aS)-3a,7,7a-trimethyl-3-(trimethylsilylmethylidene)-2,5,6,7-tetrahydro-1H-inden-4-one |
| SMILES | C[C@@H]1CCC(=O)[C@@]2(C)/C(=C\[Si](C)(C)C)CC[C@@]12C |
| InChI | InChI=1S/C16H28OSi/c1-12-7-8-14(17)16(3)13(11-18(4,5)6)9-10-15(12,16)2/h11-12H,7-10H2,1-6H3/b13-11-/t12-,15+,16-/m1/s1 |
| InChIKey | AFVDYUOMEUUUOM-XIMDKQLQSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|