C10H13BrN2O3 — CID 11033553
(4aR,5Z,7aS)-5-(bromomethylidene)-1,3,4a-trimethyl-7aH-furo[2,3-d]pyrimidine-2,4-dione (PubChem CID 11033553) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is (4aR,5Z,7aS)-5-(bromomethylidene)-1,3,4a-trimethyl-7aH-furo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (4aR,5Z,7aS)-5-(bromomethylidene)-1,3,4a-trimethyl-7aH-furo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11033553 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (4aR,5Z,7aS)-5-(bromomethylidene)-1,3,4a-trimethyl-7aH-furo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@H]2OC/C(=C\Br)[C@@]2(C)C1=O |
| InChI | InChI=1S/C10H13BrN2O3/c1-10-6(4-11)5-16-8(10)13(3)9(15)12(2)7(10)14/h4,8H,5H2,1-3H3/b6-4+/t8-,10-/m0/s1 |
| InChIKey | OIPVJSVCDIWKTH-KMPJEGIHSA-N |
| XLogP | 1.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |