About 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione
2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione (PubChem CID 143367578) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione.
Analyze 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione?
The IUPAC name of 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione (CID 143367578) is 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione.
What is the SMILES notation for 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione?
The canonical SMILES for 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione is CN1C(=O)CC2CC2N(C)C1=O.
What is the InChIKey of 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione?
The InChIKey is CPNYMPBLGHEXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-9-6-3-5(6)4-7(11)10(2)8(9)12/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione?
2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione has a molecular weight of 168.20 g/mol, XLogP of 0.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2,4-diazabicyclo[5.1.0]octane-3,5-dione is sourced from PubChem (CID 143367578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).