C6H9ClN2O2 — CID 178189048
6-chloro-1-methyl-3-(trideuteriomethyl)-1,3-diazinane-2,4-dione (PubChem CID 178189048) has the molecular formula C6H9ClN2O2 and a molecular weight of 179.62 g/mol. Its IUPAC name is 6-chloro-1-methyl-3-(trideuteriomethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 6-chloro-1-methyl-3-(trideuteriomethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178189048 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 179.62 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 6-chloro-1-methyl-3-(trideuteriomethyl)-1,3-diazinane-2,4-dione |
| SMILES | [2H]C([2H])([2H])N1C(=O)CC(Cl)N(C)C1=O |
| InChI | InChI=1S/C6H9ClN2O2/c1-8-4(7)3-5(10)9(2)6(8)11/h4H,3H2,1-2H3/i2D3 |
| InChIKey | NUJAKSXXRLICPP-BMSJAHLVSA-N |
| XLogP | 0.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.62 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|