C9H12N2O6 — CID 166696616
2-(2-hydroxy-1,3,5-trimethyl-4,6-dioxo-1,3-diazinan-5-yl)-2-oxoacetic acid (PubChem CID 166696616) has the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2-(2-hydroxy-1,3,5-trimethyl-4,6-dioxo-1,3-diazinan-5-yl)-2-oxoacetic acid.
| Compound Name | 2-(2-hydroxy-1,3,5-trimethyl-4,6-dioxo-1,3-diazinan-5-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 166696616 |
| Molecular Formula | C9H12N2O6 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(2-hydroxy-1,3,5-trimethyl-4,6-dioxo-1,3-diazinan-5-yl)-2-oxoacetic acid |
| SMILES | CN1C(=O)C(C)(C(=O)C(=O)O)C(=O)N(C)C1O |
| InChI | InChI=1S/C9H12N2O6/c1-9(4(12)5(13)14)6(15)10(2)8(17)11(3)7(9)16/h8,17H,1-3H3,(H,13,14) |
| InChIKey | QLITZZPZEMMOOO-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|