C6H11N2NaO4 — CID 175281534
sodium;5-(dihydroxymethyl)-1,3-dimethylimidazolidine-2,4-dione;hydride (PubChem CID 175281534) has the molecular formula C6H11N2NaO4 and a molecular weight of 198.15 g/mol. Its IUPAC name is sodium;5-(dihydroxymethyl)-1,3-dimethylimidazolidine-2,4-dione;hydride.
| Compound Name | sodium;5-(dihydroxymethyl)-1,3-dimethylimidazolidine-2,4-dione;hydride |
|---|---|
| PubChem CID | 175281534 |
| Molecular Formula | C6H11N2NaO4 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | sodium;5-(dihydroxymethyl)-1,3-dimethylimidazolidine-2,4-dione;hydride |
| SMILES | CN1C(=O)C(C(O)O)N(C)C1=O.[H-].[Na+] |
| InChI | InChI=1S/C6H10N2O4.Na.H/c1-7-3(5(10)11)4(9)8(2)6(7)12;;/h3,5,10-11H,1-2H3;;/q;+1;-1 |
| InChIKey | PBBGBCZJROFHLX-UHFFFAOYSA-N |
| XLogP | -4.69 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|