C9H12N2O4 — CID 74684234
1,3-dimethyl-5-propanoyl-1,3-diazinane-2,4,6-trione (PubChem CID 74684234) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 1,3-dimethyl-5-propanoyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-propanoyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 74684234 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,3-dimethyl-5-propanoyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC(=O)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C9H12N2O4/c1-4-5(12)6-7(13)10(2)9(15)11(3)8(6)14/h6H,4H2,1-3H3 |
| InChIKey | CJNYEUYZWARXCF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|