C12H18N2O4 — CID 149320751
1,3-dimethyl-5-(4-methylpentanoyl)-1,3-diazinane-2,4,6-trione (PubChem CID 149320751) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-methylpentanoyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(4-methylpentanoyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 149320751 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,3-dimethyl-5-(4-methylpentanoyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)CCC(=O)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H18N2O4/c1-7(2)5-6-8(15)9-10(16)13(3)12(18)14(4)11(9)17/h7,9H,5-6H2,1-4H3 |
| InChIKey | YAKJRZQKFKSHQX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|