C15H18N4O7 — CID 139085875
5-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxopropyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 139085875) has the molecular formula C15H18N4O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxopropyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxopropyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139085875 |
| Molecular Formula | C15H18N4O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxopropyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)C(C1C(=O)N(C)C(=O)N(C)C1=O)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H18N4O7/c1-6(20)7(8-10(21)16(2)14(25)17(3)11(8)22)9-12(23)18(4)15(26)19(5)13(9)24/h7-9H,1-5H3 |
| InChIKey | QVNOFXHATCFCIV-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 132.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|