C9H16O3 — CID 140576273
3-hydroxy-2,6-dimethylhept-2-enoic acid (PubChem CID 140576273) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 3-hydroxy-2,6-dimethylhept-2-enoic acid.
| Compound Name | 3-hydroxy-2,6-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 140576273 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3-hydroxy-2,6-dimethylhept-2-enoic acid |
| SMILES | CC(C(=O)O)=C(O)CCC(C)C |
| InChI | InChI=1S/C9H16O3/c1-6(2)4-5-8(10)7(3)9(11)12/h6,10H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | YOFZYEJYKAVCBA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|