About magnesium;hydride;4-methylpentanoic acid
magnesium;hydride;4-methylpentanoic acid (PubChem CID 174689724) has the molecular formula C6H14MgO2
and a molecular weight of 142.48 g/mol. Its IUPAC name is magnesium;hydride;4-methylpentanoic acid.
Molecular Properties
| Compound Name | magnesium;hydride;4-methylpentanoic acid |
| PubChem CID | 174689724 |
| Molecular Formula | C6H14MgO2 |
| Molecular Weight | 142.48 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | magnesium;hydride;4-methylpentanoic acid |
| SMILES | CC(C)CCC(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C6H12O2.Mg.2H/c1-5(2)3-4-6(7)8;;;/h5H,3-4H2,1-2H3,(H,7,8);;;/q;+2;2*-1 |
| InChIKey | MSRXZMFPRVYHRR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;hydride;4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;4-methylpentanoic acid?
The IUPAC name of magnesium;hydride;4-methylpentanoic acid (CID 174689724) is magnesium;hydride;4-methylpentanoic acid.
What is the SMILES notation for magnesium;hydride;4-methylpentanoic acid?
The canonical SMILES for magnesium;hydride;4-methylpentanoic acid is CC(C)CCC(=O)O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;4-methylpentanoic acid?
The InChIKey is MSRXZMFPRVYHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.Mg.2H/c1-5(2)3-4-6(7)8;;;/h5H,3-4H2,1-2H3,(H,7,8);;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;4-methylpentanoic acid?
magnesium;hydride;4-methylpentanoic acid has a molecular weight of 142.48 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;4-methylpentanoic acid is sourced from PubChem (CID 174689724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).