About 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate
4-methylpentanoic acid;2-methylpropan-1-ol;hydrate (PubChem CID 87856192) has the molecular formula C10H24O4
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate.
Molecular Properties
| Compound Name | 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate |
| PubChem CID | 87856192 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate |
| SMILES | CC(C)CCC(=O)O.CC(C)CO.O |
| InChI | InChI=1S/C6H12O2.C4H10O.H2O/c1-5(2)3-4-6(7)8;1-4(2)3-5;/h5H,3-4H2,1-2H3,(H,7,8);4-5H,3H2,1-2H3;1H2 |
| InChIKey | GGRUYNUASAPOHR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate?
The IUPAC name of 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate (CID 87856192) is 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate.
What is the SMILES notation for 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate?
The canonical SMILES for 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate is CC(C)CCC(=O)O.CC(C)CO.O.
What is the InChIKey of 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate?
The InChIKey is GGRUYNUASAPOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H10O.H2O/c1-5(2)3-4-6(7)8;1-4(2)3-5;/h5H,3-4H2,1-2H3,(H,7,8);4-5H,3H2,1-2H3;1H2.
What are the key properties of 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate?
4-methylpentanoic acid;2-methylpropan-1-ol;hydrate has a molecular weight of 208.30 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentanoic acid;2-methylpropan-1-ol;hydrate is sourced from PubChem (CID 87856192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).